C21H20N2O5 — CID 10959859
6,7,8,10,11-pentamethoxyphenanthro[9,10-d]pyrimidine (PubChem CID 10959859) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is 6,7,8,10,11-pentamethoxyphenanthro[9,10-d]pyrimidine.
| Compound Name | 6,7,8,10,11-pentamethoxyphenanthro[9,10-d]pyrimidine |
|---|---|
| PubChem CID | 10959859 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 6,7,8,10,11-pentamethoxyphenanthro[9,10-d]pyrimidine |
| SMILES | COc1cc2c(cc1OC)c1c(OC)c(OC)c(OC)cc1c1cncnc21 |
| InChI | InChI=1S/C21H20N2O5/c1-24-15-6-11-13(8-16(15)25-2)19-14(9-22-10-23-19)12-7-17(26-3)20(27-4)21(28-5)18(11)12/h6-10H,1-5H3 |
| InChIKey | AMXUKOVJIAYUFJ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|