C30H43NO4Si — CID 10962271
tert-butyl (4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5-prop-2-enyl-1,3-oxazolidine-3-carboxylate (PubChem CID 10962271) has the molecular formula C30H43NO4Si and a molecular weight of 509.76 g/mol. Its IUPAC name is tert-butyl (4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5-prop-2-enyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5-prop-2-enyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10962271 |
| Molecular Formula | C30H43NO4Si |
| Molecular Weight | 509.76 g/mol |
| Exact Mass | 509.30 |
| IUPAC Name | tert-butyl (4R,5R)-4-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,2-dimethyl-5-prop-2-enyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C=CC[C@H]1OC(C)(C)N(C(=O)OC(C)(C)C)[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H43NO4Si/c1-10-17-26-25(31(30(8,9)34-26)27(32)35-28(2,3)4)22-33-36(29(5,6)7,23-18-13-11-14-19-23)24-20-15-12-16-21-24/h10-16,18-21,25-26H,1,17,22H2,2-9H3/t25-,26-/m1/s1 |
| InChIKey | YVXTVDDAQCKVKC-CLJLJLNGSA-N |
| XLogP | 5.88 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.76 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|