C28H36N2O6S — CID 10962466
benzyl N-[(2R,3S,4S,5S)-3-hydroxy-5-methyl-1-[(4R,5S)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-2-methylsulfanyl-1-oxoheptan-4-yl]-N-methylcarbamate (PubChem CID 10962466) has the molecular formula C28H36N2O6S and a molecular weight of 528.67 g/mol. Its IUPAC name is benzyl N-[(2R,3S,4S,5S)-3-hydroxy-5-methyl-1-[(4R,5S)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-2-methylsulfanyl-1-oxoheptan-4-yl]-N-methylcarbamate.
| Compound Name | benzyl N-[(2R,3S,4S,5S)-3-hydroxy-5-methyl-1-[(4R,5S)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-2-methylsulfanyl-1-oxoheptan-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 10962466 |
| Molecular Formula | C28H36N2O6S |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | benzyl N-[(2R,3S,4S,5S)-3-hydroxy-5-methyl-1-[(4R,5S)-4-methyl-2-oxo-5-phenyl-1,3-oxazolidin-3-yl]-2-methylsulfanyl-1-oxoheptan-4-yl]-N-methylcarbamate |
| SMILES | CC[C@H](C)[C@@H]([C@H](O)[C@@H](SC)C(=O)N1C(=O)O[C@@H](c2ccccc2)[C@H]1C)N(C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H36N2O6S/c1-6-18(2)22(29(4)27(33)35-17-20-13-9-7-10-14-20)23(31)25(37-5)26(32)30-19(3)24(36-28(30)34)21-15-11-8-12-16-21/h7-16,18-19,22-25,31H,6,17H2,1-5H3/t18-,19+,22-,23-,24+,25+/m0/s1 |
| InChIKey | LXQXAONIKUMTGM-FJJHSCLASA-N |
| XLogP | 4.87 |
| TPSA | 96.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |