C41H55NO3SSi2 — CID 10963544
(3E,5E,7R)-7-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]-3-methyl-2-trimethylsilyloxyocta-3,5-dienenitrile (PubChem CID 10963544) has the molecular formula C41H55NO3SSi2 and a molecular weight of 698.13 g/mol. Its IUPAC name is (3E,5E,7R)-7-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]-3-methyl-2-trimethylsilyloxyocta-3,5-dienenitrile.
| Compound Name | (3E,5E,7R)-7-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]-3-methyl-2-trimethylsilyloxyocta-3,5-dienenitrile |
|---|---|
| PubChem CID | 10963544 |
| Molecular Formula | C41H55NO3SSi2 |
| Molecular Weight | 698.13 g/mol |
| Exact Mass | 697.34 |
| IUPAC Name | (3E,5E,7R)-7-[(2R,4R,6S)-4-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-6-phenylsulfanyloxan-2-yl]-3-methyl-2-trimethylsilyloxyocta-3,5-dienenitrile |
| SMILES | C/C(=C\C=C\[C@@H](C)[C@H]1C[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)C[C@H](Sc2ccccc2)O1)C(C#N)O[Si](C)(C)C |
| InChI | InChI=1S/C41H55NO3SSi2/c1-32(19-18-20-33(2)39(31-42)45-47(6,7)8)38-29-34(30-40(44-38)46-35-21-12-9-13-22-35)27-28-43-48(41(3,4)5,36-23-14-10-15-24-36)37-25-16-11-17-26-37/h9-26,32,34,38-40H,27-30H2,1-8H3/b19-18+,33-20+/t32-,34-,38-,39?,40+/m1/s1 |
| InChIKey | WMXRUSAABJBSIO-HILSBQNISA-N |
| XLogP | 9.75 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.13 |
| LogP ≤ 5 | 9.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|