C25H34N2O2SSi — CID 10961448
(3E,5E,7R)-7-[(2R,4R,6S)-4-(cyanomethyl)-6-phenylsulfanyloxan-2-yl]-3-methyl-2-trimethylsilyloxyocta-3,5-dienenitrile (PubChem CID 10961448) has the molecular formula C25H34N2O2SSi and a molecular weight of 454.71 g/mol. Its IUPAC name is (3E,5E,7R)-7-[(2R,4R,6S)-4-(cyanomethyl)-6-phenylsulfanyloxan-2-yl]-3-methyl-2-trimethylsilyloxyocta-3,5-dienenitrile.
| Compound Name | (3E,5E,7R)-7-[(2R,4R,6S)-4-(cyanomethyl)-6-phenylsulfanyloxan-2-yl]-3-methyl-2-trimethylsilyloxyocta-3,5-dienenitrile |
|---|---|
| PubChem CID | 10961448 |
| Molecular Formula | C25H34N2O2SSi |
| Molecular Weight | 454.71 g/mol |
| Exact Mass | 454.21 |
| IUPAC Name | (3E,5E,7R)-7-[(2R,4R,6S)-4-(cyanomethyl)-6-phenylsulfanyloxan-2-yl]-3-methyl-2-trimethylsilyloxyocta-3,5-dienenitrile |
| SMILES | C/C(=C\C=C\[C@@H](C)[C@H]1C[C@@H](CC#N)C[C@H](Sc2ccccc2)O1)C(C#N)O[Si](C)(C)C |
| InChI | InChI=1S/C25H34N2O2SSi/c1-19(10-9-11-20(2)24(18-27)29-31(3,4)5)23-16-21(14-15-26)17-25(28-23)30-22-12-7-6-8-13-22/h6-13,19,21,23-25H,14,16-17H2,1-5H3/b10-9+,20-11+/t19-,21-,23-,24?,25+/m1/s1 |
| InChIKey | DKGFVUWKZQOSHW-VVAMQFEVSA-N |
| XLogP | 6.70 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.71 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|