C28H40N2O2SSi — CID 15336978
(3E,5E,7R)-2-[tert-butyl(dimethyl)silyl]oxy-7-[(2R,4R,6S)-4-(cyanomethyl)-6-phenylsulfanyloxan-2-yl]-3-methylocta-3,5-dienenitrile (PubChem CID 15336978) has the molecular formula C28H40N2O2SSi and a molecular weight of 496.79 g/mol. Its IUPAC name is (3E,5E,7R)-2-[tert-butyl(dimethyl)silyl]oxy-7-[(2R,4R,6S)-4-(cyanomethyl)-6-phenylsulfanyloxan-2-yl]-3-methylocta-3,5-dienenitrile.
| Compound Name | (3E,5E,7R)-2-[tert-butyl(dimethyl)silyl]oxy-7-[(2R,4R,6S)-4-(cyanomethyl)-6-phenylsulfanyloxan-2-yl]-3-methylocta-3,5-dienenitrile |
|---|---|
| PubChem CID | 15336978 |
| Molecular Formula | C28H40N2O2SSi |
| Molecular Weight | 496.79 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | (3E,5E,7R)-2-[tert-butyl(dimethyl)silyl]oxy-7-[(2R,4R,6S)-4-(cyanomethyl)-6-phenylsulfanyloxan-2-yl]-3-methylocta-3,5-dienenitrile |
| SMILES | C/C(=C\C=C\[C@@H](C)[C@H]1C[C@@H](CC#N)C[C@H](Sc2ccccc2)O1)C(C#N)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H40N2O2SSi/c1-21(12-11-13-22(2)26(20-30)32-34(6,7)28(3,4)5)25-18-23(16-17-29)19-27(31-25)33-24-14-9-8-10-15-24/h8-15,21,23,25-27H,16,18-19H2,1-7H3/b12-11+,22-13+/t21-,23-,25-,26?,27+/m1/s1 |
| InChIKey | GZSRYMGIDOPCOE-SYAOELHQSA-N |
| XLogP | 7.87 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.79 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|