C10H17NO — CID 10964900
3-(2-methoxycyclohexa-1,4-dien-1-yl)propan-1-amine (PubChem CID 10964900) has the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. Its IUPAC name is 3-(2-methoxycyclohexa-1,4-dien-1-yl)propan-1-amine.
| Compound Name | 3-(2-methoxycyclohexa-1,4-dien-1-yl)propan-1-amine |
|---|---|
| PubChem CID | 10964900 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 3-(2-methoxycyclohexa-1,4-dien-1-yl)propan-1-amine |
| SMILES | COC1=C(CCCN)CC=CC1 |
| InChI | InChI=1S/C10H17NO/c1-12-10-7-3-2-5-9(10)6-4-8-11/h2-3H,4-8,11H2,1H3 |
| InChIKey | OGWDWBWAIRRKEI-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|