C12H19N — CID 10965077
(2E)-5,9-dimethyldeca-2,8-dienenitrile (PubChem CID 10965077) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is (2E)-5,9-dimethyldeca-2,8-dienenitrile.
| Compound Name | (2E)-5,9-dimethyldeca-2,8-dienenitrile |
|---|---|
| PubChem CID | 10965077 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | (2E)-5,9-dimethyldeca-2,8-dienenitrile |
| SMILES | CC(C)=CCCC(C)C/C=C/C#N |
| InChI | InChI=1S/C12H19N/c1-11(2)7-6-9-12(3)8-4-5-10-13/h4-5,7,12H,6,8-9H2,1-3H3/b5-4+ |
| InChIKey | PBXPWAOTBQNSHR-SNAWJCMRSA-N |
| XLogP | 3.84 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|