C10H14O3 — CID 10965149
(3aS,7aR)-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carbaldehyde (PubChem CID 10965149) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is (3aS,7aR)-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | (3aS,7aR)-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 10965149 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | (3aS,7aR)-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carbaldehyde |
| SMILES | CC1(C)O[C@H]2C=C(C=O)CC[C@H]2O1 |
| InChI | InChI=1S/C10H14O3/c1-10(2)12-8-4-3-7(6-11)5-9(8)13-10/h5-6,8-9H,3-4H2,1-2H3/t8-,9+/m1/s1 |
| InChIKey | YXFGHMPWCBMQLR-BDAKNGLRSA-N |
| XLogP | 1.43 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|