C10H13FO5 — CID 10752023
(3aS,7R,7aS)-4-fluoro-7-(methoxymethoxy)-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carbaldehyde (PubChem CID 10752023) has the molecular formula C10H13FO5 and a molecular weight of 232.21 g/mol. Its IUPAC name is (3aS,7R,7aS)-4-fluoro-7-(methoxymethoxy)-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | (3aS,7R,7aS)-4-fluoro-7-(methoxymethoxy)-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 10752023 |
| Molecular Formula | C10H13FO5 |
| Molecular Weight | 232.21 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (3aS,7R,7aS)-4-fluoro-7-(methoxymethoxy)-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carbaldehyde |
| SMILES | COCO[C@@H]1CC(C=O)=C(F)[C@H]2OCO[C@H]21 |
| InChI | InChI=1S/C10H13FO5/c1-13-4-14-7-2-6(3-12)8(11)10-9(7)15-5-16-10/h3,7,9-10H,2,4-5H2,1H3/t7-,9+,10-/m1/s1 |
| InChIKey | XQPIUXHIAWZYGJ-FKTZTGRPSA-N |
| XLogP | 0.54 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.21 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|