C13H20O6 — CID 135074465
(3aS,6S,7R,7aS)-6-methoxy-7-(methoxymethoxy)-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carbaldehyde (PubChem CID 135074465) has the molecular formula C13H20O6 and a molecular weight of 272.30 g/mol. Its IUPAC name is (3aS,6S,7R,7aS)-6-methoxy-7-(methoxymethoxy)-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carbaldehyde.
| Compound Name | (3aS,6S,7R,7aS)-6-methoxy-7-(methoxymethoxy)-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carbaldehyde |
|---|---|
| PubChem CID | 135074465 |
| Molecular Formula | C13H20O6 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | (3aS,6S,7R,7aS)-6-methoxy-7-(methoxymethoxy)-2,2-dimethyl-3a,6,7,7a-tetrahydro-1,3-benzodioxole-5-carbaldehyde |
| SMILES | COCO[C@H]1[C@H]2OC(C)(C)O[C@H]2C=C(C=O)[C@@H]1OC |
| InChI | InChI=1S/C13H20O6/c1-13(2)18-9-5-8(6-14)10(16-4)12(11(9)19-13)17-7-15-3/h5-6,9-12H,7H2,1-4H3/t9-,10-,11-,12+/m0/s1 |
| InChIKey | SBXSXJLWMAXIDP-FIQHERPVSA-N |
| XLogP | 0.65 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|