C16H20O2 — CID 10966763
2-hydroxy-2-[(E)-2-methylpent-3-en-2-yl]-3,4-dihydronaphthalen-1-one (PubChem CID 10966763) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-hydroxy-2-[(E)-2-methylpent-3-en-2-yl]-3,4-dihydronaphthalen-1-one.
| Compound Name | 2-hydroxy-2-[(E)-2-methylpent-3-en-2-yl]-3,4-dihydronaphthalen-1-one |
|---|---|
| PubChem CID | 10966763 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 2-hydroxy-2-[(E)-2-methylpent-3-en-2-yl]-3,4-dihydronaphthalen-1-one |
| SMILES | C/C=C/C(C)(C)C1(O)CCc2ccccc2C1=O |
| InChI | InChI=1S/C16H20O2/c1-4-10-15(2,3)16(18)11-9-12-7-5-6-8-13(12)14(16)17/h4-8,10,18H,9,11H2,1-3H3/b10-4+ |
| InChIKey | ZUPYFQBFDBLHON-ONNFQVAWSA-N |
| XLogP | 3.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|