C17H30O2Si — CID 10968422
tert-butyl-dimethyl-[(6-pent-4-enyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)oxy]silane (PubChem CID 10968422) has the molecular formula C17H30O2Si and a molecular weight of 294.51 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(6-pent-4-enyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)oxy]silane.
| Compound Name | tert-butyl-dimethyl-[(6-pent-4-enyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)oxy]silane |
|---|---|
| PubChem CID | 10968422 |
| Molecular Formula | C17H30O2Si |
| Molecular Weight | 294.51 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | tert-butyl-dimethyl-[(6-pent-4-enyl-7-oxabicyclo[4.1.0]hept-2-en-2-yl)oxy]silane |
| SMILES | C=CCCCC12CCC=C(O[Si](C)(C)C(C)(C)C)C1O2 |
| InChI | InChI=1S/C17H30O2Si/c1-7-8-9-12-17-13-10-11-14(15(17)18-17)19-20(5,6)16(2,3)4/h7,11,15H,1,8-10,12-13H2,2-6H3 |
| InChIKey | BZLLRHBXUFAYJA-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|