C20H26O3 — CID 10969055
methyl 2-[(1R,2S,3S)-2-pent-2-ynyl-3-phenylmethoxycyclopentyl]acetate (PubChem CID 10969055) has the molecular formula C20H26O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is methyl 2-[(1R,2S,3S)-2-pent-2-ynyl-3-phenylmethoxycyclopentyl]acetate.
| Compound Name | methyl 2-[(1R,2S,3S)-2-pent-2-ynyl-3-phenylmethoxycyclopentyl]acetate |
|---|---|
| PubChem CID | 10969055 |
| Molecular Formula | C20H26O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | methyl 2-[(1R,2S,3S)-2-pent-2-ynyl-3-phenylmethoxycyclopentyl]acetate |
| SMILES | CCC#CC[C@H]1[C@@H](CC(=O)OC)CC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H26O3/c1-3-4-6-11-18-17(14-20(21)22-2)12-13-19(18)23-15-16-9-7-5-8-10-16/h5,7-10,17-19H,3,11-15H2,1-2H3/t17-,18+,19+/m1/s1 |
| InChIKey | HSGFXUMFKVXMIK-QYZOEREBSA-N |
| XLogP | 3.96 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|