C18H26O8 — CID 10970688
diethyl 3-[(E)-2-acetyloxyethenyl]-4-(2-methoxy-2-oxoethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 10970688) has the molecular formula C18H26O8 and a molecular weight of 370.40 g/mol. Its IUPAC name is diethyl 3-[(E)-2-acetyloxyethenyl]-4-(2-methoxy-2-oxoethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | diethyl 3-[(E)-2-acetyloxyethenyl]-4-(2-methoxy-2-oxoethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10970688 |
| Molecular Formula | C18H26O8 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | diethyl 3-[(E)-2-acetyloxyethenyl]-4-(2-methoxy-2-oxoethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)CC(/C=C/OC(C)=O)C(CC(=O)OC)C1 |
| InChI | InChI=1S/C18H26O8/c1-5-24-16(21)18(17(22)25-6-2)10-13(7-8-26-12(3)19)14(11-18)9-15(20)23-4/h7-8,13-14H,5-6,9-11H2,1-4H3/b8-7+ |
| InChIKey | WWBRSQAYNYEQMF-BQYQJAHWSA-N |
| XLogP | 1.77 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|