C20H40O5Si2 — CID 10971775
[(2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxocyclohexyl] acetate (PubChem CID 10971775) has the molecular formula C20H40O5Si2 and a molecular weight of 416.71 g/mol. Its IUPAC name is [(2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxocyclohexyl] acetate.
| Compound Name | [(2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxocyclohexyl] acetate |
|---|---|
| PubChem CID | 10971775 |
| Molecular Formula | C20H40O5Si2 |
| Molecular Weight | 416.71 g/mol |
| Exact Mass | 416.24 |
| IUPAC Name | [(2R,6R)-2,6-bis[[tert-butyl(dimethyl)silyl]oxy]-4-oxocyclohexyl] acetate |
| SMILES | CC(=O)OC1[C@H](O[Si](C)(C)C(C)(C)C)CC(=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H40O5Si2/c1-14(21)23-18-16(24-26(8,9)19(2,3)4)12-15(22)13-17(18)25-27(10,11)20(5,6)7/h16-18H,12-13H2,1-11H3/t16-,17-/m1/s1 |
| InChIKey | APDALRQDJALNEI-IAGOWNOFSA-N |
| XLogP | 5.06 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.71 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|