C24H27N3O5S — CID 10972724
benzyl (2S)-3-[(5R)-1,3-dimethyl-4-oxo-2-sulfanylidene-1,3-diazinan-5-yl]-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 10972724) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is benzyl (2S)-3-[(5R)-1,3-dimethyl-4-oxo-2-sulfanylidene-1,3-diazinan-5-yl]-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | benzyl (2S)-3-[(5R)-1,3-dimethyl-4-oxo-2-sulfanylidene-1,3-diazinan-5-yl]-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 10972724 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | benzyl (2S)-3-[(5R)-1,3-dimethyl-4-oxo-2-sulfanylidene-1,3-diazinan-5-yl]-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | CN1C[C@@H](C[C@H](NC(=O)OCc2ccccc2)C(=O)OCc2ccccc2)C(=O)N(C)C1=S |
| InChI | InChI=1S/C24H27N3O5S/c1-26-14-19(21(28)27(2)24(26)33)13-20(22(29)31-15-17-9-5-3-6-10-17)25-23(30)32-16-18-11-7-4-8-12-18/h3-12,19-20H,13-16H2,1-2H3,(H,25,30)/t19-,20+/m1/s1 |
| InChIKey | GIJUGUWOWDNGGW-UXHICEINSA-N |
| XLogP | 2.72 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|