C30H44N2O4Si — CID 10973392
tert-butyl (3S,4E)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminobutanoate (PubChem CID 10973392) has the molecular formula C30H44N2O4Si and a molecular weight of 524.78 g/mol. Its IUPAC name is tert-butyl (3S,4E)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminobutanoate.
| Compound Name | tert-butyl (3S,4E)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminobutanoate |
|---|---|
| PubChem CID | 10973392 |
| Molecular Formula | C30H44N2O4Si |
| Molecular Weight | 524.78 g/mol |
| Exact Mass | 524.31 |
| IUPAC Name | tert-butyl (3S,4E)-3-[tert-butyl(diphenyl)silyl]oxy-4-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminobutanoate |
| SMILES | COC[C@@H]1CCCN1/N=C/[C@H](CC(=O)OC(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C30H44N2O4Si/c1-29(2,3)35-28(33)21-25(22-31-32-20-14-15-24(32)23-34-7)36-37(30(4,5)6,26-16-10-8-11-17-26)27-18-12-9-13-19-27/h8-13,16-19,22,24-25H,14-15,20-21,23H2,1-7H3/b31-22+/t24-,25-/m0/s1 |
| InChIKey | VPVCUWRYYWTGEB-NYVGXGLWSA-N |
| XLogP | 4.76 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.78 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|