C26H38N2O2Si — CID 11396502
(E)-4-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]butan-1-imine (PubChem CID 11396502) has the molecular formula C26H38N2O2Si and a molecular weight of 438.69 g/mol. Its IUPAC name is (E)-4-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]butan-1-imine.
| Compound Name | (E)-4-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]butan-1-imine |
|---|---|
| PubChem CID | 11396502 |
| Molecular Formula | C26H38N2O2Si |
| Molecular Weight | 438.69 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | (E)-4-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]butan-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C/CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H38N2O2Si/c1-26(2,3)31(24-15-7-5-8-16-24,25-17-9-6-10-18-25)30-21-12-11-19-27-28-20-13-14-23(28)22-29-4/h5-10,15-19,23H,11-14,20-22H2,1-4H3/b27-19+/t23-/m0/s1 |
| InChIKey | YLZGYXJDJKSSMR-MAIZJUNESA-N |
| XLogP | 4.44 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.69 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|