C31H40N2O2Si — CID 10907229
(E,2S)-2-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-phenylpropan-1-imine (PubChem CID 10907229) has the molecular formula C31H40N2O2Si and a molecular weight of 500.76 g/mol. Its IUPAC name is (E,2S)-2-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-phenylpropan-1-imine.
| Compound Name | (E,2S)-2-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-phenylpropan-1-imine |
|---|---|
| PubChem CID | 10907229 |
| Molecular Formula | C31H40N2O2Si |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 500.29 |
| IUPAC Name | (E,2S)-2-[tert-butyl(diphenyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-3-phenylpropan-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C/[C@H](Cc1ccccc1)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C31H40N2O2Si/c1-31(2,3)36(29-18-10-6-11-19-29,30-20-12-7-13-21-30)35-28(23-26-15-8-5-9-16-26)24-32-33-22-14-17-27(33)25-34-4/h5-13,15-16,18-21,24,27-28H,14,17,22-23,25H2,1-4H3/b32-24+/t27-,28-/m0/s1 |
| InChIKey | WZYPVKWYTFHZQI-MZFMHLIOSA-N |
| XLogP | 5.27 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|