C23H40N2O2Si — CID 11188904
(E,2S)-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]butan-1-imine (PubChem CID 11188904) has the molecular formula C23H40N2O2Si and a molecular weight of 404.67 g/mol. Its IUPAC name is (E,2S)-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]butan-1-imine.
| Compound Name | (E,2S)-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]butan-1-imine |
|---|---|
| PubChem CID | 11188904 |
| Molecular Formula | C23H40N2O2Si |
| Molecular Weight | 404.67 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | (E,2S)-2-[(R)-[tert-butyl(dimethyl)silyl]oxy-phenylmethyl]-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]butan-1-imine |
| SMILES | CC[C@@H](/C=N/N1CCC[C@H]1COC)[C@@H](O[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C23H40N2O2Si/c1-8-19(17-24-25-16-12-15-21(25)18-26-5)22(20-13-10-9-11-14-20)27-28(6,7)23(2,3)4/h9-11,13-14,17,19,21-22H,8,12,15-16,18H2,1-7H3/b24-17+/t19-,21-,22+/m0/s1 |
| InChIKey | WRIXGHCZOCREAJ-PHUXGPIKSA-N |
| XLogP | 5.87 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.67 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|