C20H32N2O2 — CID 11232847
(E,2R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-(phenylmethoxymethyl)hexan-1-imine (PubChem CID 11232847) has the molecular formula C20H32N2O2 and a molecular weight of 332.49 g/mol. Its IUPAC name is (E,2R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-(phenylmethoxymethyl)hexan-1-imine.
| Compound Name | (E,2R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-(phenylmethoxymethyl)hexan-1-imine |
|---|---|
| PubChem CID | 11232847 |
| Molecular Formula | C20H32N2O2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.25 |
| IUPAC Name | (E,2R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-(phenylmethoxymethyl)hexan-1-imine |
| SMILES | CCCC[C@H](/C=N/N1CCC[C@H]1COC)COCc1ccccc1 |
| InChI | InChI=1S/C20H32N2O2/c1-3-4-9-19(16-24-15-18-10-6-5-7-11-18)14-21-22-13-8-12-20(22)17-23-2/h5-7,10-11,14,19-20H,3-4,8-9,12-13,15-17H2,1-2H3/b21-14+/t19-,20+/m1/s1 |
| InChIKey | RHMCEDLQLJEGQF-SFRRKPOLSA-N |
| XLogP | 4.11 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|