C18H28N2O2 — CID 11358622
(E,2R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-(phenylmethoxymethyl)butan-1-imine (PubChem CID 11358622) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is (E,2R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-(phenylmethoxymethyl)butan-1-imine.
| Compound Name | (E,2R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-(phenylmethoxymethyl)butan-1-imine |
|---|---|
| PubChem CID | 11358622 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | (E,2R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-(phenylmethoxymethyl)butan-1-imine |
| SMILES | CC[C@H](/C=N/N1CCC[C@H]1COC)COCc1ccccc1 |
| InChI | InChI=1S/C18H28N2O2/c1-3-16(13-22-14-17-8-5-4-6-9-17)12-19-20-11-7-10-18(20)15-21-2/h4-6,8-9,12,16,18H,3,7,10-11,13-15H2,1-2H3/b19-12+/t16-,18+/m1/s1 |
| InChIKey | KURMOSGVARKFOU-YMTWKCNESA-N |
| XLogP | 3.33 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|