C22H28N2O2 — CID 11416880
(E,2R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-phenyl-3-phenylmethoxypropan-1-imine (PubChem CID 11416880) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is (E,2R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-phenyl-3-phenylmethoxypropan-1-imine.
| Compound Name | (E,2R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-phenyl-3-phenylmethoxypropan-1-imine |
|---|---|
| PubChem CID | 11416880 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | (E,2R)-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-2-phenyl-3-phenylmethoxypropan-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C/[C@H](COCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H28N2O2/c1-25-18-22-13-8-14-24(22)23-15-21(20-11-6-3-7-12-20)17-26-16-19-9-4-2-5-10-19/h2-7,9-12,15,21-22H,8,13-14,16-18H2,1H3/b23-15+/t21-,22+/m1/s1 |
| InChIKey | RFDZGYPCRAXZSN-WCQUILQHSA-N |
| XLogP | 4.08 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|