C28H36N2O5 — CID 10939763
dimethyl 2-[(1E,2R)-1-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-3-methylbutan-2-yl]propanedioate (PubChem CID 10939763) has the molecular formula C28H36N2O5 and a molecular weight of 480.61 g/mol. Its IUPAC name is dimethyl 2-[(1E,2R)-1-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-3-methylbutan-2-yl]propanedioate.
| Compound Name | dimethyl 2-[(1E,2R)-1-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-3-methylbutan-2-yl]propanedioate |
|---|---|
| PubChem CID | 10939763 |
| Molecular Formula | C28H36N2O5 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | dimethyl 2-[(1E,2R)-1-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-3-methylbutan-2-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H](/C=N/N1CCC[C@H]1C(OC)(c1ccccc1)c1ccccc1)C(C)C |
| InChI | InChI=1S/C28H36N2O5/c1-20(2)23(25(26(31)33-3)27(32)34-4)19-29-30-18-12-17-24(30)28(35-5,21-13-8-6-9-14-21)22-15-10-7-11-16-22/h6-11,13-16,19-20,23-25H,12,17-18H2,1-5H3/b29-19+/t23-,24+/m1/s1 |
| InChIKey | HHAJJZJVUSOYNB-CAXXYNIISA-N |
| XLogP | 4.26 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|