C35H36N2O5 — CID 12014702
dimethyl 2-[(1S,2E)-2-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-1-naphthalen-2-ylethyl]propanedioate (PubChem CID 12014702) has the molecular formula C35H36N2O5 and a molecular weight of 564.68 g/mol. Its IUPAC name is dimethyl 2-[(1S,2E)-2-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-1-naphthalen-2-ylethyl]propanedioate.
| Compound Name | dimethyl 2-[(1S,2E)-2-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-1-naphthalen-2-ylethyl]propanedioate |
|---|---|
| PubChem CID | 12014702 |
| Molecular Formula | C35H36N2O5 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | dimethyl 2-[(1S,2E)-2-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-1-naphthalen-2-ylethyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H](/C=N/N1CCC[C@H]1C(OC)(c1ccccc1)c1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C35H36N2O5/c1-40-33(38)32(34(39)41-2)30(27-21-20-25-13-10-11-14-26(25)23-27)24-36-37-22-12-19-31(37)35(42-3,28-15-6-4-7-16-28)29-17-8-5-9-18-29/h4-11,13-18,20-21,23-24,30-32H,12,19,22H2,1-3H3/b36-24+/t30-,31+/m1/s1 |
| InChIKey | GQYKMEWIKURZSR-YXKITSQHSA-N |
| XLogP | 5.93 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|