C33H38N2O5 — CID 177383596
dimethyl 2-[(1E,2R)-1-[(2S)-2-(benzhydryloxymethyl)pyrrolidin-1-yl]imino-4-phenylbutan-2-yl]propanedioate (PubChem CID 177383596) has the molecular formula C33H38N2O5 and a molecular weight of 542.68 g/mol. Its IUPAC name is dimethyl 2-[(1E,2R)-1-[(2S)-2-(benzhydryloxymethyl)pyrrolidin-1-yl]imino-4-phenylbutan-2-yl]propanedioate.
| Compound Name | dimethyl 2-[(1E,2R)-1-[(2S)-2-(benzhydryloxymethyl)pyrrolidin-1-yl]imino-4-phenylbutan-2-yl]propanedioate |
|---|---|
| PubChem CID | 177383596 |
| Molecular Formula | C33H38N2O5 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.28 |
| IUPAC Name | dimethyl 2-[(1E,2R)-1-[(2S)-2-(benzhydryloxymethyl)pyrrolidin-1-yl]imino-4-phenylbutan-2-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H](/C=N/N1CCC[C@H]1COC(c1ccccc1)c1ccccc1)CCc1ccccc1 |
| InChI | InChI=1S/C33H38N2O5/c1-38-32(36)30(33(37)39-2)28(21-20-25-13-6-3-7-14-25)23-34-35-22-12-19-29(35)24-40-31(26-15-8-4-9-16-26)27-17-10-5-11-18-27/h3-11,13-18,23,28-31H,12,19-22,24H2,1-2H3/b34-23+/t28-,29-/m0/s1 |
| InChIKey | TZRQTNLFVLVMRC-ATVQDJJESA-N |
| XLogP | 5.45 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|