C37H38N2O5 — CID 11093149
dimethyl 2-[(1S,2E)-2-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-1-(3-phenylphenyl)ethyl]propanedioate (PubChem CID 11093149) has the molecular formula C37H38N2O5 and a molecular weight of 590.72 g/mol. Its IUPAC name is dimethyl 2-[(1S,2E)-2-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-1-(3-phenylphenyl)ethyl]propanedioate.
| Compound Name | dimethyl 2-[(1S,2E)-2-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-1-(3-phenylphenyl)ethyl]propanedioate |
|---|---|
| PubChem CID | 11093149 |
| Molecular Formula | C37H38N2O5 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.28 |
| IUPAC Name | dimethyl 2-[(1S,2E)-2-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-1-(3-phenylphenyl)ethyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@H](/C=N/N1CCC[C@H]1C(OC)(c1ccccc1)c1ccccc1)c1cccc(-c2ccccc2)c1 |
| InChI | InChI=1S/C37H38N2O5/c1-42-35(40)34(36(41)43-2)32(29-18-13-17-28(25-29)27-15-7-4-8-16-27)26-38-39-24-14-23-33(39)37(44-3,30-19-9-5-10-20-30)31-21-11-6-12-22-31/h4-13,15-22,25-26,32-34H,14,23-24H2,1-3H3/b38-26+/t32-,33+/m1/s1 |
| InChIKey | ORJJHTPQUVLXDW-IUGMPYMESA-N |
| XLogP | 6.44 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|