C26H32N2O5 — CID 11419610
dimethyl 2-[(1E,2R)-1-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]iminopropan-2-yl]propanedioate (PubChem CID 11419610) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is dimethyl 2-[(1E,2R)-1-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]iminopropan-2-yl]propanedioate.
| Compound Name | dimethyl 2-[(1E,2R)-1-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]iminopropan-2-yl]propanedioate |
|---|---|
| PubChem CID | 11419610 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | dimethyl 2-[(1E,2R)-1-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]iminopropan-2-yl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H](C)/C=N/N1CCC[C@H]1C(OC)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H32N2O5/c1-19(23(24(29)31-2)25(30)32-3)18-27-28-17-11-16-22(28)26(33-4,20-12-7-5-8-13-20)21-14-9-6-10-15-21/h5-10,12-15,18-19,22-23H,11,16-17H2,1-4H3/b27-18+/t19-,22-/m0/s1 |
| InChIKey | RQVBUDFANDMOCR-WRNVMTIGSA-N |
| XLogP | 3.63 |
| TPSA | 77.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|