C28H29F3N2O2 — CID 11730554
(2S,3E)-2-benzyl-1,1,1-trifluoro-3-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]iminopropan-2-ol (PubChem CID 11730554) has the molecular formula C28H29F3N2O2 and a molecular weight of 482.55 g/mol. Its IUPAC name is (2S,3E)-2-benzyl-1,1,1-trifluoro-3-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]iminopropan-2-ol.
| Compound Name | (2S,3E)-2-benzyl-1,1,1-trifluoro-3-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]iminopropan-2-ol |
|---|---|
| PubChem CID | 11730554 |
| Molecular Formula | C28H29F3N2O2 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (2S,3E)-2-benzyl-1,1,1-trifluoro-3-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]iminopropan-2-ol |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@@H]1CCCN1/N=C/[C@@](O)(Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C28H29F3N2O2/c1-35-27(23-14-7-3-8-15-23,24-16-9-4-10-17-24)25-18-11-19-33(25)32-21-26(34,28(29,30)31)20-22-12-5-2-6-13-22/h2-10,12-17,21,25,34H,11,18-20H2,1H3/b32-21+/t25-,26-/m0/s1 |
| InChIKey | ZFTORJBIBHCYOO-YBFGJLQKSA-N |
| XLogP | 5.56 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|