C27H35F3N2O2 — CID 10719380
(E)-2-benzyl-3,3,3-trifluoro-N-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-2-phenylmethoxypropan-1-imine (PubChem CID 10719380) has the molecular formula C27H35F3N2O2 and a molecular weight of 476.58 g/mol. Its IUPAC name is (E)-2-benzyl-3,3,3-trifluoro-N-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-2-phenylmethoxypropan-1-imine.
| Compound Name | (E)-2-benzyl-3,3,3-trifluoro-N-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-2-phenylmethoxypropan-1-imine |
|---|---|
| PubChem CID | 10719380 |
| Molecular Formula | C27H35F3N2O2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | (E)-2-benzyl-3,3,3-trifluoro-N-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]-2-phenylmethoxypropan-1-imine |
| SMILES | CCC(CC)(OC)[C@@H]1CCCN1/N=C/C(Cc1ccccc1)(OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C27H35F3N2O2/c1-4-25(5-2,33-3)24-17-12-18-32(24)31-21-26(27(28,29)30,19-22-13-8-6-9-14-22)34-20-23-15-10-7-11-16-23/h6-11,13-16,21,24H,4-5,12,17-20H2,1-3H3/b31-21+/t24-,26?/m0/s1 |
| InChIKey | OSGKCQOKOOQJDP-CDNNUXOXSA-N |
| XLogP | 6.40 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|