C35H35F3N2O2 — CID 134875491
(E,2S)-2-benzyl-3,3,3-trifluoro-N-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-2-phenylmethoxypropan-1-imine (PubChem CID 134875491) has the molecular formula C35H35F3N2O2 and a molecular weight of 572.67 g/mol. Its IUPAC name is (E,2S)-2-benzyl-3,3,3-trifluoro-N-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-2-phenylmethoxypropan-1-imine.
| Compound Name | (E,2S)-2-benzyl-3,3,3-trifluoro-N-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-2-phenylmethoxypropan-1-imine |
|---|---|
| PubChem CID | 134875491 |
| Molecular Formula | C35H35F3N2O2 |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | (E,2S)-2-benzyl-3,3,3-trifluoro-N-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-2-phenylmethoxypropan-1-imine |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@@H]1CCCN1/N=C/[C@](Cc1ccccc1)(OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C35H35F3N2O2/c1-41-34(30-19-10-4-11-20-30,31-21-12-5-13-22-31)32-23-14-24-40(32)39-27-33(35(36,37)38,25-28-15-6-2-7-16-28)42-26-29-17-8-3-9-18-29/h2-13,15-22,27,32H,14,23-26H2,1H3/b39-27+/t32-,33-/m0/s1 |
| InChIKey | DQWVJLGECGUNLU-NYVLQEMPSA-N |
| XLogP | 7.79 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|