C28H37F3N2O2 — CID 177448133
(2R)-1,1,1-trifluoro-2-[(E)-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]iminomethyl]nonan-2-ol (PubChem CID 177448133) has the molecular formula C28H37F3N2O2 and a molecular weight of 490.61 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-2-[(E)-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]iminomethyl]nonan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-2-[(E)-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]iminomethyl]nonan-2-ol |
|---|---|
| PubChem CID | 177448133 |
| Molecular Formula | C28H37F3N2O2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | (2R)-1,1,1-trifluoro-2-[(E)-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]iminomethyl]nonan-2-ol |
| SMILES | CCCCCCC[C@@](O)(/C=N/N1CCC[C@H]1C(OC)(c1ccccc1)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C28H37F3N2O2/c1-3-4-5-6-13-20-26(34,28(29,30)31)22-32-33-21-14-19-25(33)27(35-2,23-15-9-7-10-16-23)24-17-11-8-12-18-24/h7-12,15-18,22,25,34H,3-6,13-14,19-21H2,1-2H3/b32-22+/t25-,26+/m0/s1 |
| InChIKey | FGFMQMVYHORQHD-PNIXLQARSA-N |
| XLogP | 6.68 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|