C14H17F3N2O — CID 10613190
(E)-3,3,3-trifluoro-2-methoxy-2-phenyl-N-pyrrolidin-1-ylpropan-1-imine (PubChem CID 10613190) has the molecular formula C14H17F3N2O and a molecular weight of 286.30 g/mol. Its IUPAC name is (E)-3,3,3-trifluoro-2-methoxy-2-phenyl-N-pyrrolidin-1-ylpropan-1-imine.
| Compound Name | (E)-3,3,3-trifluoro-2-methoxy-2-phenyl-N-pyrrolidin-1-ylpropan-1-imine |
|---|---|
| PubChem CID | 10613190 |
| Molecular Formula | C14H17F3N2O |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (E)-3,3,3-trifluoro-2-methoxy-2-phenyl-N-pyrrolidin-1-ylpropan-1-imine |
| SMILES | COC(/C=N/N1CCCC1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C14H17F3N2O/c1-20-13(14(15,16)17,12-7-3-2-4-8-12)11-18-19-9-5-6-10-19/h2-4,7-8,11H,5-6,9-10H2,1H3/b18-11+ |
| InChIKey | AFAUYTYUHMEKIO-WOJGMQOQSA-N |
| XLogP | 3.17 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|