C13H15F3N2O — CID 15893171
(3E)-1,1,1-trifluoro-2-phenyl-3-pyrrolidin-1-yliminopropan-2-ol (PubChem CID 15893171) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is (3E)-1,1,1-trifluoro-2-phenyl-3-pyrrolidin-1-yliminopropan-2-ol.
| Compound Name | (3E)-1,1,1-trifluoro-2-phenyl-3-pyrrolidin-1-yliminopropan-2-ol |
|---|---|
| PubChem CID | 15893171 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | (3E)-1,1,1-trifluoro-2-phenyl-3-pyrrolidin-1-yliminopropan-2-ol |
| SMILES | OC(/C=N/N1CCCC1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C13H15F3N2O/c14-13(15,16)12(19,11-6-2-1-3-7-11)10-17-18-8-4-5-9-18/h1-3,6-7,10,19H,4-5,8-9H2/b17-10+ |
| InChIKey | KJVMOXZLLWZKLL-LICLKQGHSA-N |
| XLogP | 2.52 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|