C11H13F3N2O — CID 10658062
(3E)-3-(dimethylhydrazinylidene)-1,1,1-trifluoro-2-phenylpropan-2-ol (PubChem CID 10658062) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is (3E)-3-(dimethylhydrazinylidene)-1,1,1-trifluoro-2-phenylpropan-2-ol.
| Compound Name | (3E)-3-(dimethylhydrazinylidene)-1,1,1-trifluoro-2-phenylpropan-2-ol |
|---|---|
| PubChem CID | 10658062 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | (3E)-3-(dimethylhydrazinylidene)-1,1,1-trifluoro-2-phenylpropan-2-ol |
| SMILES | CN(C)/N=C/C(O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H13F3N2O/c1-16(2)15-8-10(17,11(12,13)14)9-6-4-3-5-7-9/h3-8,17H,1-2H3/b15-8+ |
| InChIKey | YNSLZFGRPLYWLE-OVCLIPMQSA-N |
| XLogP | 1.98 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|