C21H31F3N2O — CID 10833916
(E)-2-phenylmethoxy-N-pyrrolidin-1-yl-2-(trifluoromethyl)nonan-1-imine (PubChem CID 10833916) has the molecular formula C21H31F3N2O and a molecular weight of 384.49 g/mol. Its IUPAC name is (E)-2-phenylmethoxy-N-pyrrolidin-1-yl-2-(trifluoromethyl)nonan-1-imine.
| Compound Name | (E)-2-phenylmethoxy-N-pyrrolidin-1-yl-2-(trifluoromethyl)nonan-1-imine |
|---|---|
| PubChem CID | 10833916 |
| Molecular Formula | C21H31F3N2O |
| Molecular Weight | 384.49 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | (E)-2-phenylmethoxy-N-pyrrolidin-1-yl-2-(trifluoromethyl)nonan-1-imine |
| SMILES | CCCCCCCC(/C=N/N1CCCC1)(OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C21H31F3N2O/c1-2-3-4-5-9-14-20(21(22,23)24,18-25-26-15-10-11-16-26)27-17-19-12-7-6-8-13-19/h6-8,12-13,18H,2-5,9-11,14-17H2,1H3/b25-18+ |
| InChIKey | KDPQAECVTIPPDT-XIEYBQDHSA-N |
| XLogP | 5.95 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.49 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|