C15H19F3N2O2 — CID 10567403
(3E)-1,1,1-trifluoro-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-2-phenylpropan-2-ol (PubChem CID 10567403) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is (3E)-1,1,1-trifluoro-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-2-phenylpropan-2-ol.
| Compound Name | (3E)-1,1,1-trifluoro-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-2-phenylpropan-2-ol |
|---|---|
| PubChem CID | 10567403 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (3E)-1,1,1-trifluoro-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]imino-2-phenylpropan-2-ol |
| SMILES | COC[C@@H]1CCCN1/N=C/C(O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H19F3N2O2/c1-22-10-13-8-5-9-20(13)19-11-14(21,15(16,17)18)12-6-3-2-4-7-12/h2-4,6-7,11,13,21H,5,8-10H2,1H3/b19-11+/t13-,14?/m0/s1 |
| InChIKey | AHZKEVODVPJLSL-KXZCVEASSA-N |
| XLogP | 2.53 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|