C16H21F3N2O2 — CID 15852814
(3E)-2-benzyl-1,1,1-trifluoro-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminopropan-2-ol (PubChem CID 15852814) has the molecular formula C16H21F3N2O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is (3E)-2-benzyl-1,1,1-trifluoro-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminopropan-2-ol.
| Compound Name | (3E)-2-benzyl-1,1,1-trifluoro-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminopropan-2-ol |
|---|---|
| PubChem CID | 15852814 |
| Molecular Formula | C16H21F3N2O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (3E)-2-benzyl-1,1,1-trifluoro-3-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]iminopropan-2-ol |
| SMILES | COC[C@@H]1CCCN1/N=C/C(O)(Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H21F3N2O2/c1-23-11-14-8-5-9-21(14)20-12-15(22,16(17,18)19)10-13-6-3-2-4-7-13/h2-4,6-7,12,14,22H,5,8-11H2,1H3/b20-12+/t14-,15?/m0/s1 |
| InChIKey | NPRYDWBPQBLJEU-HRHWORQNSA-N |
| XLogP | 2.62 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|