C19H27F3N2O2 — CID 10595452
(3E)-1,1,1-trifluoro-3-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-2-phenylpropan-2-ol (PubChem CID 10595452) has the molecular formula C19H27F3N2O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is (3E)-1,1,1-trifluoro-3-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-2-phenylpropan-2-ol.
| Compound Name | (3E)-1,1,1-trifluoro-3-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-2-phenylpropan-2-ol |
|---|---|
| PubChem CID | 10595452 |
| Molecular Formula | C19H27F3N2O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (3E)-1,1,1-trifluoro-3-[(2S)-2-(3-methoxypentan-3-yl)pyrrolidin-1-yl]imino-2-phenylpropan-2-ol |
| SMILES | CCC(CC)(OC)[C@@H]1CCCN1/N=C/C(O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C19H27F3N2O2/c1-4-17(5-2,26-3)16-12-9-13-24(16)23-14-18(25,19(20,21)22)15-10-7-6-8-11-15/h6-8,10-11,14,16,25H,4-5,9,12-13H2,1-3H3/b23-14+/t16-,18?/m0/s1 |
| InChIKey | GULMFUXYCZVRSX-ALGDVRGDSA-N |
| XLogP | 4.09 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|