C20H21F3N2O — CID 10832478
(E)-3,3,3-trifluoro-2-phenyl-2-phenylmethoxy-N-pyrrolidin-1-ylpropan-1-imine (PubChem CID 10832478) has the molecular formula C20H21F3N2O and a molecular weight of 362.40 g/mol. Its IUPAC name is (E)-3,3,3-trifluoro-2-phenyl-2-phenylmethoxy-N-pyrrolidin-1-ylpropan-1-imine.
| Compound Name | (E)-3,3,3-trifluoro-2-phenyl-2-phenylmethoxy-N-pyrrolidin-1-ylpropan-1-imine |
|---|---|
| PubChem CID | 10832478 |
| Molecular Formula | C20H21F3N2O |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | (E)-3,3,3-trifluoro-2-phenyl-2-phenylmethoxy-N-pyrrolidin-1-ylpropan-1-imine |
| SMILES | FC(F)(F)C(/C=N/N1CCCC1)(OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H21F3N2O/c21-20(22,23)19(18-11-5-2-6-12-18,16-24-25-13-7-8-14-25)26-15-17-9-3-1-4-10-17/h1-6,9-12,16H,7-8,13-15H2/b24-16+ |
| InChIKey | HUOXBQTZXLVWEX-LFVJCYFKSA-N |
| XLogP | 4.74 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|