C15H19F3N2O — CID 10851756
(E)-2-benzyl-3,3,3-trifluoro-2-methoxy-N-pyrrolidin-1-ylpropan-1-imine (PubChem CID 10851756) has the molecular formula C15H19F3N2O and a molecular weight of 300.32 g/mol. Its IUPAC name is (E)-2-benzyl-3,3,3-trifluoro-2-methoxy-N-pyrrolidin-1-ylpropan-1-imine.
| Compound Name | (E)-2-benzyl-3,3,3-trifluoro-2-methoxy-N-pyrrolidin-1-ylpropan-1-imine |
|---|---|
| PubChem CID | 10851756 |
| Molecular Formula | C15H19F3N2O |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (E)-2-benzyl-3,3,3-trifluoro-2-methoxy-N-pyrrolidin-1-ylpropan-1-imine |
| SMILES | COC(/C=N/N1CCCC1)(Cc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H19F3N2O/c1-21-14(15(16,17)18,11-13-7-3-2-4-8-13)12-19-20-9-5-6-10-20/h2-4,7-8,12H,5-6,9-11H2,1H3/b19-12+ |
| InChIKey | OBWSOGRVLNCAJG-XDHOZWIPSA-N |
| XLogP | 3.26 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|