C21H23F3N2O — CID 10571562
(E)-2-benzyl-3,3,3-trifluoro-2-phenylmethoxy-N-pyrrolidin-1-ylpropan-1-imine (PubChem CID 10571562) has the molecular formula C21H23F3N2O and a molecular weight of 376.42 g/mol. Its IUPAC name is (E)-2-benzyl-3,3,3-trifluoro-2-phenylmethoxy-N-pyrrolidin-1-ylpropan-1-imine.
| Compound Name | (E)-2-benzyl-3,3,3-trifluoro-2-phenylmethoxy-N-pyrrolidin-1-ylpropan-1-imine |
|---|---|
| PubChem CID | 10571562 |
| Molecular Formula | C21H23F3N2O |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | (E)-2-benzyl-3,3,3-trifluoro-2-phenylmethoxy-N-pyrrolidin-1-ylpropan-1-imine |
| SMILES | FC(F)(F)C(/C=N/N1CCCC1)(Cc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C21H23F3N2O/c22-21(23,24)20(15-18-9-3-1-4-10-18,17-25-26-13-7-8-14-26)27-16-19-11-5-2-6-12-19/h1-6,9-12,17H,7-8,13-16H2/b25-17+ |
| InChIKey | MFNXUZFPWVAMMI-KOEQRZSOSA-N |
| XLogP | 4.83 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|