C34H33F3N2O2 — CID 15893174
(E,2S)-3,3,3-trifluoro-N-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-2-phenyl-2-phenylmethoxypropan-1-imine (PubChem CID 15893174) has the molecular formula C34H33F3N2O2 and a molecular weight of 558.64 g/mol. Its IUPAC name is (E,2S)-3,3,3-trifluoro-N-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-2-phenyl-2-phenylmethoxypropan-1-imine.
| Compound Name | (E,2S)-3,3,3-trifluoro-N-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-2-phenyl-2-phenylmethoxypropan-1-imine |
|---|---|
| PubChem CID | 15893174 |
| Molecular Formula | C34H33F3N2O2 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | (E,2S)-3,3,3-trifluoro-N-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-2-phenyl-2-phenylmethoxypropan-1-imine |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@@H]1CCCN1/N=C/[C@@](OCc1ccccc1)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C34H33F3N2O2/c1-40-33(29-19-10-4-11-20-29,30-21-12-5-13-22-30)31-23-14-24-39(31)38-26-32(34(35,36)37,28-17-8-3-9-18-28)41-25-27-15-6-2-7-16-27/h2-13,15-22,26,31H,14,23-25H2,1H3/b38-26+/t31-,32+/m0/s1 |
| InChIKey | LJKJLQOFNURVNQ-VNESMGDNSA-N |
| XLogP | 7.70 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|