C35H43F3N2O2 — CID 177499341
(E,2S)-N-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-2-phenylmethoxy-2-(trifluoromethyl)nonan-1-imine (PubChem CID 177499341) has the molecular formula C35H43F3N2O2 and a molecular weight of 580.74 g/mol. Its IUPAC name is (E,2S)-N-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-2-phenylmethoxy-2-(trifluoromethyl)nonan-1-imine.
| Compound Name | (E,2S)-N-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-2-phenylmethoxy-2-(trifluoromethyl)nonan-1-imine |
|---|---|
| PubChem CID | 177499341 |
| Molecular Formula | C35H43F3N2O2 |
| Molecular Weight | 580.74 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | (E,2S)-N-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]-2-phenylmethoxy-2-(trifluoromethyl)nonan-1-imine |
| SMILES | CCCCCCC[C@@](/C=N/N1CCC[C@H]1C(OC)(c1ccccc1)c1ccccc1)(OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C35H43F3N2O2/c1-3-4-5-6-16-25-33(35(36,37)38,42-27-29-18-10-7-11-19-29)28-39-40-26-17-24-32(40)34(41-2,30-20-12-8-13-21-30)31-22-14-9-15-23-31/h7-15,18-23,28,32H,3-6,16-17,24-27H2,1-2H3/b39-28+/t32-,33-/m0/s1 |
| InChIKey | TXWFFOCMIBYCEU-WAQZXHEFSA-N |
| XLogP | 8.91 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.74 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|