C27H27F3N2O2 — CID 177403715
(2R,3E)-1,1,1-trifluoro-3-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-2-phenylpropan-2-ol (PubChem CID 177403715) has the molecular formula C27H27F3N2O2 and a molecular weight of 468.52 g/mol. Its IUPAC name is (2R,3E)-1,1,1-trifluoro-3-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-2-phenylpropan-2-ol.
| Compound Name | (2R,3E)-1,1,1-trifluoro-3-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-2-phenylpropan-2-ol |
|---|---|
| PubChem CID | 177403715 |
| Molecular Formula | C27H27F3N2O2 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.20 |
| IUPAC Name | (2R,3E)-1,1,1-trifluoro-3-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-2-phenylpropan-2-ol |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@@H]1CCCN1/N=C/[C@](O)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C27H27F3N2O2/c1-34-26(22-14-7-3-8-15-22,23-16-9-4-10-17-23)24-18-11-19-32(24)31-20-25(33,27(28,29)30)21-12-5-2-6-13-21/h2-10,12-17,20,24,33H,11,18-19H2,1H3/b31-20+/t24-,25-/m0/s1 |
| InChIKey | HGPYRVAMUKKHHE-BAQUIHPSSA-N |
| XLogP | 5.48 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|