C22H25F3N2O2 — CID 177403990
(3E)-1,1,1-trifluoro-3-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-2-methylpropan-2-ol (PubChem CID 177403990) has the molecular formula C22H25F3N2O2 and a molecular weight of 406.45 g/mol. Its IUPAC name is (3E)-1,1,1-trifluoro-3-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-2-methylpropan-2-ol.
| Compound Name | (3E)-1,1,1-trifluoro-3-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 177403990 |
| Molecular Formula | C22H25F3N2O2 |
| Molecular Weight | 406.45 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (3E)-1,1,1-trifluoro-3-[(2S)-2-[methoxy(diphenyl)methyl]pyrrolidin-1-yl]imino-2-methylpropan-2-ol |
| SMILES | COC(c1ccccc1)(c1ccccc1)[C@@H]1CCCN1/N=C/C(C)(O)C(F)(F)F |
| InChI | InChI=1S/C22H25F3N2O2/c1-20(28,22(23,24)25)16-26-27-15-9-14-19(27)21(29-2,17-10-5-3-6-11-17)18-12-7-4-8-13-18/h3-8,10-13,16,19,28H,9,14-15H2,1-2H3/b26-16+/t19-,20?/m0/s1 |
| InChIKey | BPVGMZZVFTYWEE-VMZGSLLBSA-N |
| XLogP | 4.34 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|