C30H46N2O2Si — CID 11145457
(E,2R)-6-[tert-butyl(dimethyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylhexan-1-imine (PubChem CID 11145457) has the molecular formula C30H46N2O2Si and a molecular weight of 494.80 g/mol. Its IUPAC name is (E,2R)-6-[tert-butyl(dimethyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylhexan-1-imine.
| Compound Name | (E,2R)-6-[tert-butyl(dimethyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylhexan-1-imine |
|---|---|
| PubChem CID | 11145457 |
| Molecular Formula | C30H46N2O2Si |
| Molecular Weight | 494.80 g/mol |
| Exact Mass | 494.33 |
| IUPAC Name | (E,2R)-6-[tert-butyl(dimethyl)silyl]oxy-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylhexan-1-imine |
| SMILES | COC[C@@H]1CCCN1/N=C(/c1ccccc1)[C@H](CCCCO[Si](C)(C)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C30H46N2O2Si/c1-30(2,3)35(5,6)34-23-14-13-21-28(25-16-9-7-10-17-25)29(26-18-11-8-12-19-26)31-32-22-15-20-27(32)24-33-4/h7-12,16-19,27-28H,13-15,20-24H2,1-6H3/b31-29-/t27-,28+/m0/s1 |
| InChIKey | DUQZNBNKQIETKP-CWHHPGTKSA-N |
| XLogP | 7.48 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.80 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|