C21H26N2O — CID 134875177
(Z)-N-[2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylpropan-1-imine (PubChem CID 134875177) has the molecular formula C21H26N2O and a molecular weight of 322.45 g/mol. Its IUPAC name is (Z)-N-[2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylpropan-1-imine.
| Compound Name | (Z)-N-[2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylpropan-1-imine |
|---|---|
| PubChem CID | 134875177 |
| Molecular Formula | C21H26N2O |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.20 |
| IUPAC Name | (Z)-N-[2-(methoxymethyl)pyrrolidin-1-yl]-1,2-diphenylpropan-1-imine |
| SMILES | COCC1CCCN1/N=C(\c1ccccc1)C(C)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O/c1-17(18-10-5-3-6-11-18)21(19-12-7-4-8-13-19)22-23-15-9-14-20(23)16-24-2/h3-8,10-13,17,20H,9,14-16H2,1-2H3/b22-21- |
| InChIKey | NUBMDCUPOVWEDJ-DQRAZIAOSA-N |
| XLogP | 4.31 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|