C18H26N2O2 — CID 15207823
(Z,3S)-3-benzyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]oxan-2-imine (PubChem CID 15207823) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is (Z,3S)-3-benzyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]oxan-2-imine.
| Compound Name | (Z,3S)-3-benzyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]oxan-2-imine |
|---|---|
| PubChem CID | 15207823 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (Z,3S)-3-benzyl-N-[(2S)-2-(methoxymethyl)pyrrolidin-1-yl]oxan-2-imine |
| SMILES | COC[C@@H]1CCCN1/N=C1\OCCC[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C18H26N2O2/c1-21-14-17-10-5-11-20(17)19-18-16(9-6-12-22-18)13-15-7-3-2-4-8-15/h2-4,7-8,16-17H,5-6,9-14H2,1H3/b19-18-/t16-,17-/m0/s1 |
| InChIKey | SHXVEOGJCLJUCI-BQLSZWSRSA-N |
| XLogP | 3.08 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|